C13H14Br2N2S — CID 105015176
1-(2,5-dibromophenyl)-N-ethyl-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 105015176) has the molecular formula C13H14Br2N2S and a molecular weight of 390.14 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-N-ethyl-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(2,5-dibromophenyl)-N-ethyl-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 105015176 |
| Molecular Formula | C13H14Br2N2S |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 1-(2,5-dibromophenyl)-N-ethyl-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | CCNC(Cc1nccs1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H14Br2N2S/c1-2-16-12(8-13-17-5-6-18-13)10-7-9(14)3-4-11(10)15/h3-7,12,16H,2,8H2,1H3 |
| InChIKey | DQDSMXKXUCRVAS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |