C13H18ClF2N — CID 105017296
1-(4-chloro-2,5-difluorophenyl)-N-ethyl-2-methylbutan-1-amine (PubChem CID 105017296) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-2-methylbutan-1-amine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 105017296 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N-ethyl-2-methylbutan-1-amine |
| SMILES | CCNC(c1cc(F)c(Cl)cc1F)C(C)CC |
| InChI | InChI=1S/C13H18ClF2N/c1-4-8(3)13(17-5-2)9-6-12(16)10(14)7-11(9)15/h6-8,13,17H,4-5H2,1-3H3 |
| InChIKey | SNFZGLBFXOORMJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|