C18H20N4O5 — CID 1050182
ethyl 2-[(2S)-1-(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)-3-oxopiperazin-2-yl]acetate (PubChem CID 1050182) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S)-1-(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 1050182 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | ethyl 2-[(2S)-1-(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)NCCN1c1nc2c(C)cccn2c(=O)c1C=O |
| InChI | InChI=1S/C18H20N4O5/c1-3-27-14(24)9-13-17(25)19-6-8-21(13)16-12(10-23)18(26)22-7-4-5-11(2)15(22)20-16/h4-5,7,10,13H,3,6,8-9H2,1-2H3,(H,19,25)/t13-/m0/s1 |
| InChIKey | UBCGCAFFUFJSHB-ZDUSSCGKSA-N |
| XLogP | 0.07 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|