C25H29N5O5S2 — CID 98150578
methyl 2-[(2S)-1-[9-methyl-4-oxo-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]-3-oxopiperazin-2-yl]acetate (PubChem CID 98150578) has the molecular formula C25H29N5O5S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[9-methyl-4-oxo-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[9-methyl-4-oxo-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 98150578 |
| Molecular Formula | C25H29N5O5S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | methyl 2-[(2S)-1-[9-methyl-4-oxo-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCN1C(=O)/C(=C/c2c(N3CCNC(=O)[C@@H]3CC(=O)OC)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C25H29N5O5S2/c1-4-5-6-10-30-24(34)18(37-25(30)36)13-16-21(27-20-15(2)8-7-11-29(20)23(16)33)28-12-9-26-22(32)17(28)14-19(31)35-3/h7-8,11,13,17H,4-6,9-10,12,14H2,1-3H3,(H,26,32)/b18-13-/t17-/m0/s1 |
| InChIKey | MXAHZVQGDVBNLG-XIDKLXSXSA-N |
| XLogP | 2.26 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|