About [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate
[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate (PubChem CID 10501858) has the molecular formula C22H21ClN2O4
and a molecular weight of 412.87 g/mol. Its IUPAC name is [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate |
| PubChem CID | 10501858 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate |
| SMILES | CCC(OC(=O)c1ccc(Cl)cc1)C(=O)c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H21ClN2O4/c1-4-18(29-22(28)15-10-12-16(23)13-11-15)20(26)19-14(2)24(3)25(21(19)27)17-8-6-5-7-9-17/h5-13,18H,4H2,1-3H3 |
| InChIKey | LGHKXCUAEOFOPI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate?
The IUPAC name of [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate (CID 10501858) is [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate.
What is the SMILES notation for [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate?
The canonical SMILES for [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate is CCC(OC(=O)c1ccc(Cl)cc1)C(=O)c1c(C)n(C)n(-c2ccccc2)c1=O.
What is the InChIKey of [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate?
The InChIKey is LGHKXCUAEOFOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O4/c1-4-18(29-22(28)15-10-12-16(23)13-11-15)20(26)19-14(2)24(3)25(21(19)27)17-8-6-5-7-9-17/h5-13,18H,4H2,1-3H3.
What are the key properties of [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate?
[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate has a molecular weight of 412.87 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-oxobutan-2-yl] 4-chlorobenzoate is sourced from PubChem (CID 10501858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).