C22H14ClN5S — CID 10501998
4-(2-chlorophenyl)-3-(2-phenyl-1,8-naphthyridin-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 10501998) has the molecular formula C22H14ClN5S and a molecular weight of 415.91 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-(2-phenyl-1,8-naphthyridin-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-chlorophenyl)-3-(2-phenyl-1,8-naphthyridin-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10501998 |
| Molecular Formula | C22H14ClN5S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-(2-chlorophenyl)-3-(2-phenyl-1,8-naphthyridin-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc3cccnc3nc2-c2ccccc2)n1-c1ccccc1Cl |
| InChI | InChI=1S/C22H14ClN5S/c23-17-10-4-5-11-18(17)28-21(26-27-22(28)29)16-13-15-9-6-12-24-20(15)25-19(16)14-7-2-1-3-8-14/h1-13H,(H,27,29) |
| InChIKey | MQXQYIVKPLQDDJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|