C16H14ClN3S — CID 2164226
3-(2-chlorophenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 2164226) has the molecular formula C16H14ClN3S and a molecular weight of 315.83 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-chlorophenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2164226 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(2-chlorophenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2c(-c3ccccc3Cl)n[nH]c2=S)c1C |
| InChI | InChI=1S/C16H14ClN3S/c1-10-6-5-9-14(11(10)2)20-15(18-19-16(20)21)12-7-3-4-8-13(12)17/h3-9H,1-2H3,(H,19,21) |
| InChIKey | SVFVVRIYIMNNFO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|