C24H28N6S2 — CID 4072251
4-(2,3-dimethylphenyl)-3-[4-[4-(2,3-dimethylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione (PubChem CID 4072251) has the molecular formula C24H28N6S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-3-[4-[4-(2,3-dimethylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,3-dimethylphenyl)-3-[4-[4-(2,3-dimethylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4072251 |
| Molecular Formula | C24H28N6S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-3-[4-[4-(2,3-dimethylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2c(CCCCc3n[nH]c(=S)n3-c3cccc(C)c3C)n[nH]c2=S)c1C |
| InChI | InChI=1S/C24H28N6S2/c1-15-9-7-11-19(17(15)3)29-21(25-27-23(29)31)13-5-6-14-22-26-28-24(32)30(22)20-12-8-10-16(2)18(20)4/h7-12H,5-6,13-14H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | FFDYIRCDUVXUGL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|