C15H13N3S — CID 667526
3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 667526) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 667526 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-benzyl-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H13N3S/c19-15-17-16-14(11-12-7-3-1-4-8-12)18(15)13-9-5-2-6-10-13/h1-10H,11H2,(H,17,19) |
| InChIKey | NORNNMHDCZHPNP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|