C19H19N3O2S — CID 143589112
3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 143589112) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143589112 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(2,3-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2c(-c3cc(C4CC4)c(O)cc3O)n[nH]c2=S)c1C |
| InChI | InChI=1S/C19H19N3O2S/c1-10-4-3-5-15(11(10)2)22-18(20-21-19(22)25)14-8-13(12-6-7-12)16(23)9-17(14)24/h3-5,8-9,12,23-24H,6-7H2,1-2H3,(H,21,25) |
| InChIKey | JTRYRGXNAILQQY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|