C19H15N3O2S — CID 136620807
3-(4-hydroxy-2-methylphenyl)-4-(5-hydroxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 136620807) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methylphenyl)-4-(5-hydroxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-hydroxy-2-methylphenyl)-4-(5-hydroxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136620807 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-(4-hydroxy-2-methylphenyl)-4-(5-hydroxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(O)ccc1-c1n[nH]c(=S)n1-c1cccc2c(O)cccc12 |
| InChI | InChI=1S/C19H15N3O2S/c1-11-10-12(23)8-9-13(11)18-20-21-19(25)22(18)16-6-2-5-15-14(16)4-3-7-17(15)24/h2-10,23-24H,1H3,(H,21,25) |
| InChIKey | CKNOATFQJSNNLX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|