C25H17N3OS — CID 136620870
3-(4-hydroxy-2-methylphenyl)-4-pyren-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 136620870) has the molecular formula C25H17N3OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methylphenyl)-4-pyren-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-hydroxy-2-methylphenyl)-4-pyren-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136620870 |
| Molecular Formula | C25H17N3OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-(4-hydroxy-2-methylphenyl)-4-pyren-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(O)ccc1-c1n[nH]c(=S)n1-c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C25H17N3OS/c1-14-13-18(29)9-11-19(14)24-26-27-25(30)28(24)21-12-8-17-6-5-15-3-2-4-16-7-10-20(21)23(17)22(15)16/h2-13,29H,1H3,(H,27,30) |
| InChIKey | VMURLTDTFZBHTF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|