C19H18N4O2S — CID 137147853
3-(2,4-dihydroxyphenyl)-4-(2-propan-2-yl-1H-indol-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 137147853) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)-4-(2-propan-2-yl-1H-indol-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dihydroxyphenyl)-4-(2-propan-2-yl-1H-indol-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 137147853 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-4-(2-propan-2-yl-1H-indol-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)c1cc2c(-n3c(-c4ccc(O)cc4O)n[nH]c3=S)cccc2[nH]1 |
| InChI | InChI=1S/C19H18N4O2S/c1-10(2)15-9-13-14(20-15)4-3-5-16(13)23-18(21-22-19(23)26)12-7-6-11(24)8-17(12)25/h3-10,20,24-25H,1-2H3,(H,22,26) |
| InChIKey | FFWYABUEIZMHEJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|