C14H11FN4O2S — CID 143232501
3-(2,4-dihydroxyphenyl)-4-[4-(fluoroamino)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 143232501) has the molecular formula C14H11FN4O2S and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)-4-[4-(fluoroamino)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dihydroxyphenyl)-4-[4-(fluoroamino)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143232501 |
| Molecular Formula | C14H11FN4O2S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-4-[4-(fluoroamino)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc(-c2n[nH]c(=S)n2-c2ccc(NF)cc2)c(O)c1 |
| InChI | InChI=1S/C14H11FN4O2S/c15-16-8-1-3-9(4-2-8)19-13(17-18-14(19)22)11-6-5-10(20)7-12(11)21/h1-7,16,20-21H,(H,18,22) |
| InChIKey | GSOUBETWQICLBO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|