C18H19N3O3S — CID 143289776
3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-hydroxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 143289776) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-hydroxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143289776 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)c1cc(-c2n[nH]c(=S)n2-c2ccc(O)cc2)c(O)cc1O |
| InChI | InChI=1S/C18H19N3O3S/c1-18(2,3)13-8-12(14(23)9-15(13)24)16-19-20-17(25)21(16)10-4-6-11(22)7-5-10/h4-9,22-24H,1-3H3,(H,20,25) |
| InChIKey | QIICCIHOJLBFDS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|