C37H41N3O11S — CID 162204595
5-tert-butyl-2,4-dihydroxybenzoic acid;3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione;2,4-dihydroxybenzoic acid (PubChem CID 162204595) has the molecular formula C37H41N3O11S and a molecular weight of 735.81 g/mol. Its IUPAC name is 5-tert-butyl-2,4-dihydroxybenzoic acid;3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione;2,4-dihydroxybenzoic acid.
| Compound Name | 5-tert-butyl-2,4-dihydroxybenzoic acid;3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione;2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 162204595 |
| Molecular Formula | C37H41N3O11S |
| Molecular Weight | 735.81 g/mol |
| Exact Mass | 735.25 |
| IUPAC Name | 5-tert-butyl-2,4-dihydroxybenzoic acid;3-(5-tert-butyl-2,4-dihydroxyphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione;2,4-dihydroxybenzoic acid |
| SMILES | CC(C)(C)c1cc(C(=O)O)c(O)cc1O.COc1ccc(-n2c(-c3cc(C(C)(C)C)c(O)cc3O)n[nH]c2=S)cc1.O=C(O)c1ccc(O)cc1O |
| InChI | InChI=1S/C19H21N3O3S.C11H14O4.C7H6O4/c1-19(2,3)14-9-13(15(23)10-16(14)24)17-20-21-18(26)22(17)11-5-7-12(25-4)8-6-11;1-11(2,3)7-4-6(10(14)15)8(12)5-9(7)13;8-4-1-2-5(7(10)11)6(9)3-4/h5-10,23-24H,1-4H3,(H,21,26);4-5,12-13H,1-3H3,(H,14,15);1-3,8-9H,(H,10,11) |
| InChIKey | ZSAGXKDPRDHLQP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 238.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|