C21H24N4O4S — CID 135616800
3-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-morpholin-4-ylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135616800) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-morpholin-4-ylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-morpholin-4-ylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135616800 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-(5-ethyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-morpholin-4-ylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2ccc(OC)c(N3CCOCC3)c2)c(O)cc1O |
| InChI | InChI=1S/C21H24N4O4S/c1-3-13-10-15(18(27)12-17(13)26)20-22-23-21(30)25(20)14-4-5-19(28-2)16(11-14)24-6-8-29-9-7-24/h4-5,10-12,26-27H,3,6-9H2,1-2H3,(H,23,30) |
| InChIKey | FFWUEMBNZFLCNE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|