C22H27N5O2S — CID 143526946
3-(2-amino-5-ethyl-4-hydroxyphenyl)-4-(4-methoxy-3-piperidin-1-ylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 143526946) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 3-(2-amino-5-ethyl-4-hydroxyphenyl)-4-(4-methoxy-3-piperidin-1-ylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-amino-5-ethyl-4-hydroxyphenyl)-4-(4-methoxy-3-piperidin-1-ylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143526946 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-(2-amino-5-ethyl-4-hydroxyphenyl)-4-(4-methoxy-3-piperidin-1-ylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2ccc(OC)c(N3CCCCC3)c2)c(N)cc1O |
| InChI | InChI=1S/C22H27N5O2S/c1-3-14-11-16(17(23)13-19(14)28)21-24-25-22(30)27(21)15-7-8-20(29-2)18(12-15)26-9-5-4-6-10-26/h7-8,11-13,28H,3-6,9-10,23H2,1-2H3,(H,25,30) |
| InChIKey | PTDOCNAKCWUTMT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|