C13H16N4O — CID 168514328
4-(4-methoxy-3-pyrrolidin-1-ylphenyl)-1,2,4-triazole (PubChem CID 168514328) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-(4-methoxy-3-pyrrolidin-1-ylphenyl)-1,2,4-triazole.
| Compound Name | 4-(4-methoxy-3-pyrrolidin-1-ylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 168514328 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(4-methoxy-3-pyrrolidin-1-ylphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2cnnc2)cc1N1CCCC1 |
| InChI | InChI=1S/C13H16N4O/c1-18-13-5-4-11(17-9-14-15-10-17)8-12(13)16-6-2-3-7-16/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | UPNSSTUKEIJJRJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |