C18H20N4O3S — CID 143589154
3-(5-ethyl-2,4-dihydroxyphenyl)-4-[4-methoxy-3-(methylamino)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 143589154) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-(5-ethyl-2,4-dihydroxyphenyl)-4-[4-methoxy-3-(methylamino)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-ethyl-2,4-dihydroxyphenyl)-4-[4-methoxy-3-(methylamino)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143589154 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-(5-ethyl-2,4-dihydroxyphenyl)-4-[4-methoxy-3-(methylamino)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2ccc(OC)c(NC)c2)c(O)cc1O |
| InChI | InChI=1S/C18H20N4O3S/c1-4-10-7-12(15(24)9-14(10)23)17-20-21-18(26)22(17)11-5-6-16(25-3)13(8-11)19-2/h5-9,19,23-24H,4H2,1-3H3,(H,21,26) |
| InChIKey | GTIAYSGQPKLENW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|