C19H22N4OS — CID 136503231
4-[3-(dimethylamino)phenyl]-3-(5-ethyl-2-hydroxy-4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136503231) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-[3-(dimethylamino)phenyl]-3-(5-ethyl-2-hydroxy-4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[3-(dimethylamino)phenyl]-3-(5-ethyl-2-hydroxy-4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136503231 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-[3-(dimethylamino)phenyl]-3-(5-ethyl-2-hydroxy-4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2cccc(N(C)C)c2)c(O)cc1C |
| InChI | InChI=1S/C19H22N4OS/c1-5-13-10-16(17(24)9-12(13)2)18-20-21-19(25)23(18)15-8-6-7-14(11-15)22(3)4/h6-11,24H,5H2,1-4H3,(H,21,25) |
| InChIKey | YEHGAXBWIOANPZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|