C20H23N5OS — CID 12877026
4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 12877026) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 12877026 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4c(C)n[nH]c4=S)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5OS/c1-15-21-22-20(27)25(15)18-5-3-16(4-6-18)23-11-13-24(14-12-23)17-7-9-19(26-2)10-8-17/h3-10H,11-14H2,1-2H3,(H,22,27) |
| InChIKey | BSBISBPCHOBXCL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|