C21H24N4O2 — CID 19032416
3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-4-methyl-1H-imidazol-2-one (PubChem CID 19032416) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-4-methyl-1H-imidazol-2-one.
| Compound Name | 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-4-methyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 19032416 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-4-methyl-1H-imidazol-2-one |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4c(C)c[nH]c4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-15-22-21(26)25(16)19-5-3-17(4-6-19)23-11-13-24(14-12-23)18-7-9-20(27-2)10-8-18/h3-10,15H,11-14H2,1-2H3,(H,22,26) |
| InChIKey | ZDXQCVRJYGGLKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|