C18H16ClN3OS — CID 40684636
3-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 40684636) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 3-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 40684636 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c([C@H]3C[C@@H]3c3ccc(Cl)cc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H16ClN3OS/c1-23-14-8-6-13(7-9-14)22-17(20-21-18(22)24)16-10-15(16)11-2-4-12(19)5-3-11/h2-9,15-16H,10H2,1H3,(H,21,24)/t15-,16+/m1/s1 |
| InChIKey | QKLMFWKDGOWBSV-CVEARBPZSA-N |
| XLogP | 4.86 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|