C18H17N3S — CID 932501
4-(4-methylphenyl)-3-[(1S,2S)-2-phenylcyclopropyl]-1H-1,2,4-triazole-5-thione (PubChem CID 932501) has the molecular formula C18H17N3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-[(1S,2S)-2-phenylcyclopropyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-methylphenyl)-3-[(1S,2S)-2-phenylcyclopropyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 932501 |
| Molecular Formula | C18H17N3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-(4-methylphenyl)-3-[(1S,2S)-2-phenylcyclopropyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c([C@H]3C[C@@H]3c3ccccc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H17N3S/c1-12-7-9-14(10-8-12)21-17(19-20-18(21)22)16-11-15(16)13-5-3-2-4-6-13/h2-10,15-16H,11H2,1H3,(H,20,22)/t15-,16+/m1/s1 |
| InChIKey | RQTJGNPZNZYINT-CVEARBPZSA-N |
| XLogP | 4.51 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|