C13H15N3OS — CID 102060588
3-[(1S,2R)-2-hydroxycyclopentyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 102060588) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[(1S,2R)-2-hydroxycyclopentyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(1S,2R)-2-hydroxycyclopentyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102060588 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-[(1S,2R)-2-hydroxycyclopentyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | O[C@@H]1CCC[C@H]1c1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C13H15N3OS/c17-11-8-4-7-10(11)12-14-15-13(18)16(12)9-5-2-1-3-6-9/h1-3,5-6,10-11,17H,4,7-8H2,(H,15,18)/t10-,11-/m1/s1 |
| InChIKey | WBBNMICKBZUQFB-GHMZBOCLSA-N |
| XLogP | 2.56 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|