C16H17N3O2S — CID 44758597
4-[3-(7-bicyclo[4.1.0]heptanyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid (PubChem CID 44758597) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-[3-(7-bicyclo[4.1.0]heptanyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid.
| Compound Name | 4-[3-(7-bicyclo[4.1.0]heptanyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 44758597 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-[3-(7-bicyclo[4.1.0]heptanyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2c(C3C4CCCCC43)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c20-15(21)9-5-7-10(8-6-9)19-14(17-18-16(19)22)13-11-3-1-2-4-12(11)13/h5-8,11-13H,1-4H2,(H,18,22)(H,20,21) |
| InChIKey | QJLCPVMMMPLKNZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|