C17H14ClN7OS — CID 15275541
3-[5-amino-1-(4-chlorophenyl)triazol-4-yl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 15275541) has the molecular formula C17H14ClN7OS and a molecular weight of 399.87 g/mol. Its IUPAC name is 3-[5-amino-1-(4-chlorophenyl)triazol-4-yl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[5-amino-1-(4-chlorophenyl)triazol-4-yl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 15275541 |
| Molecular Formula | C17H14ClN7OS |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-[5-amino-1-(4-chlorophenyl)triazol-4-yl]-4-(4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(-c3nnn(-c4ccc(Cl)cc4)c3N)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H14ClN7OS/c1-26-13-8-6-11(7-9-13)24-16(21-22-17(24)27)14-15(19)25(23-20-14)12-4-2-10(18)3-5-12/h2-9H,19H2,1H3,(H,22,27) |
| InChIKey | TZPYHPCQKMZYPU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|