C20H15N3O3S — CID 143627674
3-[2,5-dihydroxy-4-(1-hydroxyethenyl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 143627674) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 3-[2,5-dihydroxy-4-(1-hydroxyethenyl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2,5-dihydroxy-4-(1-hydroxyethenyl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143627674 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[2,5-dihydroxy-4-(1-hydroxyethenyl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | C=C(O)c1cc(O)c(-c2n[nH]c(=S)n2-c2cccc3ccccc23)cc1O |
| InChI | InChI=1S/C20H15N3O3S/c1-11(24)14-9-18(26)15(10-17(14)25)19-21-22-20(27)23(19)16-8-4-6-12-5-2-3-7-13(12)16/h2-10,24-26H,1H2,(H,22,27) |
| InChIKey | VDIGIKSKRJWKIT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|