C21H19N3O5S3 — CID 58102255
[5-(methylsulfonylmethyl)-2-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] methanesulfonate (PubChem CID 58102255) has the molecular formula C21H19N3O5S3 and a molecular weight of 489.60 g/mol. Its IUPAC name is [5-(methylsulfonylmethyl)-2-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] methanesulfonate.
| Compound Name | [5-(methylsulfonylmethyl)-2-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 58102255 |
| Molecular Formula | C21H19N3O5S3 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [5-(methylsulfonylmethyl)-2-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Cc1ccc(-c2n[nH]c(=S)n2-c2cccc3ccccc23)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H19N3O5S3/c1-31(25,26)13-14-10-11-17(19(12-14)29-32(2,27)28)20-22-23-21(30)24(20)18-9-5-7-15-6-3-4-8-16(15)18/h3-12H,13H2,1-2H3,(H,23,30) |
| InChIKey | FNBYUOGETSUDIG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|