C22H18N4S — CID 10737910
3-[(2-methyl-1H-indol-3-yl)methyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 10737910) has the molecular formula C22H18N4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 3-[(2-methyl-1H-indol-3-yl)methyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-methyl-1H-indol-3-yl)methyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10737910 |
| Molecular Formula | C22H18N4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-[(2-methyl-1H-indol-3-yl)methyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1[nH]c2ccccc2c1Cc1n[nH]c(=S)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C22H18N4S/c1-14-18(17-10-4-5-11-19(17)23-14)13-21-24-25-22(27)26(21)20-12-6-8-15-7-2-3-9-16(15)20/h2-12,23H,13H2,1H3,(H,25,27) |
| InChIKey | BYDNRMRXDPUKLR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|