C18H20N2S — CID 105020108
N-[(4,5-dimethylthiophen-2-yl)-quinolin-5-ylmethyl]ethanamine (PubChem CID 105020108) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)-quinolin-5-ylmethyl]ethanamine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)-quinolin-5-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 105020108 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)-quinolin-5-ylmethyl]ethanamine |
| SMILES | CCNC(c1cc(C)c(C)s1)c1cccc2ncccc12 |
| InChI | InChI=1S/C18H20N2S/c1-4-19-18(17-11-12(2)13(3)21-17)15-7-5-9-16-14(15)8-6-10-20-16/h5-11,18-19H,4H2,1-3H3 |
| InChIKey | ZIYKWDZSKFUGMI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |