C18H26N2 — CID 105176769
N,3-diethyl-1-quinolin-5-ylpentan-1-amine (PubChem CID 105176769) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N,3-diethyl-1-quinolin-5-ylpentan-1-amine.
| Compound Name | N,3-diethyl-1-quinolin-5-ylpentan-1-amine |
|---|---|
| PubChem CID | 105176769 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N,3-diethyl-1-quinolin-5-ylpentan-1-amine |
| SMILES | CCNC(CC(CC)CC)c1cccc2ncccc12 |
| InChI | InChI=1S/C18H26N2/c1-4-14(5-2)13-18(19-6-3)16-9-7-11-17-15(16)10-8-12-20-17/h7-12,14,18-19H,4-6,13H2,1-3H3 |
| InChIKey | RDWBOMVJCCURKY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |