C15H20N2O2 — CID 81231933
N-ethyl-2,2-dimethoxy-1-quinolin-5-ylethanamine (PubChem CID 81231933) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-ethyl-2,2-dimethoxy-1-quinolin-5-ylethanamine.
| Compound Name | N-ethyl-2,2-dimethoxy-1-quinolin-5-ylethanamine |
|---|---|
| PubChem CID | 81231933 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-ethyl-2,2-dimethoxy-1-quinolin-5-ylethanamine |
| SMILES | CCNC(c1cccc2ncccc12)C(OC)OC |
| InChI | InChI=1S/C15H20N2O2/c1-4-16-14(15(18-2)19-3)12-7-5-9-13-11(12)8-6-10-17-13/h5-10,14-16H,4H2,1-3H3 |
| InChIKey | FWEZTIUQAGAEMU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|