C19H28N2 — CID 105021496
N,2-diethyl-1-quinolin-7-ylhexan-1-amine (PubChem CID 105021496) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N,2-diethyl-1-quinolin-7-ylhexan-1-amine.
| Compound Name | N,2-diethyl-1-quinolin-7-ylhexan-1-amine |
|---|---|
| PubChem CID | 105021496 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N,2-diethyl-1-quinolin-7-ylhexan-1-amine |
| SMILES | CCCCC(CC)C(NCC)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C19H28N2/c1-4-7-9-15(5-2)19(20-6-3)17-12-11-16-10-8-13-21-18(16)14-17/h8,10-15,19-20H,4-7,9H2,1-3H3 |
| InChIKey | JDSYRWLMVHCFSL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |