C18H31NO — CID 105022228
1-(3-ethoxyphenyl)-N,2-diethylhexan-1-amine (PubChem CID 105022228) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-N,2-diethylhexan-1-amine.
| Compound Name | 1-(3-ethoxyphenyl)-N,2-diethylhexan-1-amine |
|---|---|
| PubChem CID | 105022228 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-(3-ethoxyphenyl)-N,2-diethylhexan-1-amine |
| SMILES | CCCCC(CC)C(NCC)c1cccc(OCC)c1 |
| InChI | InChI=1S/C18H31NO/c1-5-9-11-15(6-2)18(19-7-3)16-12-10-13-17(14-16)20-8-4/h10,12-15,18-19H,5-9,11H2,1-4H3 |
| InChIKey | AREBQGMZAAHWKC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |