C19H33NO — CID 105035820
N,2-diethyl-1-(2-propoxyphenyl)hexan-1-amine (PubChem CID 105035820) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is N,2-diethyl-1-(2-propoxyphenyl)hexan-1-amine.
| Compound Name | N,2-diethyl-1-(2-propoxyphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 105035820 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N,2-diethyl-1-(2-propoxyphenyl)hexan-1-amine |
| SMILES | CCCCC(CC)C(NCC)c1ccccc1OCCC |
| InChI | InChI=1S/C19H33NO/c1-5-9-12-16(7-3)19(20-8-4)17-13-10-11-14-18(17)21-15-6-2/h10-11,13-14,16,19-20H,5-9,12,15H2,1-4H3 |
| InChIKey | GMMJUBKTCPMWCR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |