C18H21NOS — CID 105021891
N-[1-benzothiophen-7-yl-(5-ethylfuran-2-yl)methyl]propan-1-amine (PubChem CID 105021891) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is N-[1-benzothiophen-7-yl-(5-ethylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[1-benzothiophen-7-yl-(5-ethylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105021891 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[1-benzothiophen-7-yl-(5-ethylfuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(CC)o1)c1cccc2ccsc12 |
| InChI | InChI=1S/C18H21NOS/c1-3-11-19-17(16-9-8-14(4-2)20-16)15-7-5-6-13-10-12-21-18(13)15/h5-10,12,17,19H,3-4,11H2,1-2H3 |
| InChIKey | BFWUKZCXUIRPJG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |