C18H27NS — CID 105021936
1-(1-benzothiophen-7-yl)-N-propylheptan-1-amine (PubChem CID 105021936) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-N-propylheptan-1-amine.
| Compound Name | 1-(1-benzothiophen-7-yl)-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 105021936 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-N-propylheptan-1-amine |
| SMILES | CCCCCCC(NCCC)c1cccc2ccsc12 |
| InChI | InChI=1S/C18H27NS/c1-3-5-6-7-11-17(19-13-4-2)16-10-8-9-15-12-14-20-18(15)16/h8-10,12,14,17,19H,3-7,11,13H2,1-2H3 |
| InChIKey | QHZJKLVUYJKAPT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|