C28H39NO2 — CID 10502303
(1R,2S,4R,10S,13S,14S,19R)-6-(4-methoxyphenyl)-10,14-dimethyl-5-oxa-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicos-8-ene (PubChem CID 10502303) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is (1R,2S,4R,10S,13S,14S,19R)-6-(4-methoxyphenyl)-10,14-dimethyl-5-oxa-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicos-8-ene.
| Compound Name | (1R,2S,4R,10S,13S,14S,19R)-6-(4-methoxyphenyl)-10,14-dimethyl-5-oxa-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicos-8-ene |
|---|---|
| PubChem CID | 10502303 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (1R,2S,4R,10S,13S,14S,19R)-6-(4-methoxyphenyl)-10,14-dimethyl-5-oxa-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicos-8-ene |
| SMILES | COc1ccc(N2CC=C3[C@@H](C[C@H]4[C@@H]5CC[C@H]6CCCC[C@]6(C)[C@H]5CC[C@]34C)O2)cc1 |
| InChI | InChI=1S/C28H39NO2/c1-27-15-5-4-6-19(27)7-12-22-23(27)13-16-28(2)24-14-17-29(31-26(24)18-25(22)28)20-8-10-21(30-3)11-9-20/h8-11,14,19,22-23,25-26H,4-7,12-13,15-18H2,1-3H3/t19-,22-,23+,25+,26-,27+,28-/m1/s1 |
| InChIKey | UFHVKKQHIFOILV-NFRYZJKWSA-N |
| XLogP | 6.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|