C10H14N4O — CID 105023361
4-[(6-ethylpyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 105023361) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-[(6-ethylpyrimidin-4-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(6-ethylpyrimidin-4-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 105023361 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-[(6-ethylpyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | CCc1cc(NC2CNC(=O)C2)ncn1 |
| InChI | InChI=1S/C10H14N4O/c1-2-7-3-9(13-6-12-7)14-8-4-10(15)11-5-8/h3,6,8H,2,4-5H2,1H3,(H,11,15)(H,12,13,14) |
| InChIKey | MXGJZNYXJCXAPE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |