C13H21N3 — CID 115880999
N-(3,3-dimethylcyclopentyl)-6-ethylpyrimidin-4-amine (PubChem CID 115880999) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-6-ethylpyrimidin-4-amine.
| Compound Name | N-(3,3-dimethylcyclopentyl)-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115880999 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-6-ethylpyrimidin-4-amine |
| SMILES | CCc1cc(NC2CCC(C)(C)C2)ncn1 |
| InChI | InChI=1S/C13H21N3/c1-4-10-7-12(15-9-14-10)16-11-5-6-13(2,3)8-11/h7,9,11H,4-6,8H2,1-3H3,(H,14,15,16) |
| InChIKey | MCBYOUXFXJZUKB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |