C21H28N2O — CID 10502473
2,6-ditert-butyl-4-[(1-methyl-4-pyridinylidene)methylimino]cyclohexa-2,5-dien-1-one (PubChem CID 10502473) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(1-methyl-4-pyridinylidene)methylimino]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(1-methyl-4-pyridinylidene)methylimino]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10502473 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(1-methyl-4-pyridinylidene)methylimino]cyclohexa-2,5-dien-1-one |
| SMILES | CN1C=CC(=CN=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C1 |
| InChI | InChI=1S/C21H28N2O/c1-20(2,3)17-12-16(13-18(19(17)24)21(4,5)6)22-14-15-8-10-23(7)11-9-15/h8-14H,1-7H3 |
| InChIKey | LKYCGQVPRSEMMZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|