C29H41NO2 — CID 59944993
2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 59944993) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59944993 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=CN=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C29H41NO2/c1-26(2,3)20-13-18(14-21(24(20)31)27(4,5)6)17-30-19-15-22(28(7,8)9)25(32)23(16-19)29(10,11)12/h13-17H,1-12H3 |
| InChIKey | KKWZLBWCMRTBIL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|