C43H60N2O3 — CID 14416041
4-[bis[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one (PubChem CID 14416041) has the molecular formula C43H60N2O3 and a molecular weight of 652.96 g/mol. Its IUPAC name is 4-[bis[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[bis[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 14416041 |
| Molecular Formula | C43H60N2O3 |
| Molecular Weight | 652.96 g/mol |
| Exact Mass | 652.46 |
| IUPAC Name | 4-[bis[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=NC(N=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C43H60N2O3/c1-38(2,3)28-19-25(20-29(34(28)46)39(4,5)6)37(44-26-21-30(40(7,8)9)35(47)31(22-26)41(10,11)12)45-27-23-32(42(13,14)15)36(48)33(24-27)43(16,17)18/h19-24H,1-18H3 |
| InChIKey | RPNSKZPZQLVBJO-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.96 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|