C36H58N2O2 — CID 139117063
2,4-ditert-butyl-6-tert-butyliminocyclohexa-2,4-dien-1-one (PubChem CID 139117063) has the molecular formula C36H58N2O2 and a molecular weight of 550.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-tert-butyliminocyclohexa-2,4-dien-1-one.
| Compound Name | 2,4-ditert-butyl-6-tert-butyliminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 139117063 |
| Molecular Formula | C36H58N2O2 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.45 |
| IUPAC Name | 2,4-ditert-butyl-6-tert-butyliminocyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)/N=C1\C=C(C(C)(C)C)C=C(C(C)(C)C)C1=O.CC(C)(C)/N=C1\C=C(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/2C18H29NO/c2*1-16(2,3)12-10-13(17(4,5)6)15(20)14(11-12)19-18(7,8)9/h2*10-11H,1-9H3/b2*19-14+ |
| InChIKey | QSMSCDDQGGBUJK-LJFYYWHBSA-N |
| XLogP | 9.51 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|