C30H42N2O2 — CID 102488199
2,4-ditert-butyl-6-[(E)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)amino]ethenyl]iminocyclohexa-2,4-dien-1-one (PubChem CID 102488199) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(E)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)amino]ethenyl]iminocyclohexa-2,4-dien-1-one.
| Compound Name | 2,4-ditert-butyl-6-[(E)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)amino]ethenyl]iminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 102488199 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[(E)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)amino]ethenyl]iminocyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=C/C(=N\C=C\N=C2/C=C(C(C)(C)C)C=C(C(C)(C)C)C2=O)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C30H42N2O2/c1-27(2,3)19-15-21(29(7,8)9)25(33)23(17-19)31-13-14-32-24-18-20(28(4,5)6)16-22(26(24)34)30(10,11)12/h13-18H,1-12H3/b14-13+,31-23+,32-24+ |
| InChIKey | XSQPQYSCZUIHPR-LHFIRACCSA-N |
| XLogP | 7.39 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|