C23H23F6NO2 — CID 59944942
2,6-ditert-butyl-4-[[[4-oxo-3,5-bis(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]amino]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 59944942) has the molecular formula C23H23F6NO2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[[4-oxo-3,5-bis(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]amino]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[[[4-oxo-3,5-bis(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]amino]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59944942 |
| Molecular Formula | C23H23F6NO2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2,6-ditert-butyl-4-[[[4-oxo-3,5-bis(trifluoromethyl)cyclohexa-2,5-dien-1-ylidene]amino]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=CN=C2C=C(C(F)(F)F)C(=O)C(C(F)(F)F)=C2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H23F6NO2/c1-20(2,3)14-7-12(8-15(18(14)31)21(4,5)6)11-30-13-9-16(22(24,25)26)19(32)17(10-13)23(27,28)29/h7-11H,1-6H3 |
| InChIKey | GUCYEXHHTKYOSJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|