C17H17NO2 — CID 59944919
4-[[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 59944919) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59944919 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=CN=C2C=C(C)C(=O)C(C)=C2)C=C(C)C1=O |
| InChI | InChI=1S/C17H17NO2/c1-10-5-14(6-11(2)16(10)19)9-18-15-7-12(3)17(20)13(4)8-15/h5-9H,1-4H3 |
| InChIKey | SVHQTDQXNPVBRG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|