C26H35NO2S — CID 10502511
[(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-pyridin-2-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10502511) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-pyridin-2-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-pyridin-2-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10502511 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-pyridin-2-ylsulfanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H](Sc5ccccn5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H35NO2S/c1-17(28)29-19-11-13-25(2)18(16-19)7-8-20-21-9-10-23(26(21,3)14-12-22(20)25)30-24-6-4-5-15-27-24/h4-7,15,19-23H,8-14,16H2,1-3H3/t19-,20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | BUHAGKFNTVHNEC-AMKJHPCNSA-N |
| XLogP | 6.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|